3-Dimethoxymethyl-2-methoxy-pyridine
Catalog No: FT-0678266
CAS No: 869735-23-9
- Chemical Name: 3-Dimethoxymethyl-2-methoxy-pyridine
- Molecular Formula: C9H13NO3
- Molecular Weight: 183.20
- InChI Key: BOVYWQYCFFODBK-UHFFFAOYSA-N
- InChI: InChI=1S/C9H13NO3/c1-11-8-7(5-4-6-10-8)9(12-2)13-3/h4-6,9H,1-3H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 183.20400 |
| Density: | 1.081g/cm3 |
| CAS: | 869735-23-9 |
| Bolling_Point: | 237.8ºC at 760 mmHg |
| Product_Name: | 3-(dimethoxymethyl)-2-methoxypyridine |
| Melting_Point: | N/A |
| Flash_Point: | 86.7ºC |
| MF: | C9H13NO3 |
| Density: | 1.081g/cm3 |
|---|---|
| LogP: | 1.38160 |
| Flash_Point: | 86.7ºC |
| Refractive_Index: | 1.486 |
| FW: | 183.20400 |
| PSA: | 40.58000 |
| MF: | C9H13NO3 |
| Bolling_Point: | 237.8ºC at 760 mmHg |
| Exact_Mass: | 183.09000 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Safety_Statements: | H302 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)